| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Ethoxy-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine Basic information |
| Product Name: | 2-Ethoxy-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine | | Synonyms: | 2-ETHOXYPYRIDINE-3-BORONIC ACID, PINACOL ESTER;2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine(SALTDATA: FREE);2-ethoxy-3-(tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine;Pyridine, 2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;2-Ethoxy-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine | | CAS: | 848243-23-2 | | MF: | C13H20BNO3 | | MW: | 249.11 | | EINECS: | | | Product Categories: | | | Mol File: | 848243-23-2.mol | ![2-Ethoxy-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine Structure](CAS/GIF/848243-23-2.gif) |
| | 2-Ethoxy-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine Chemical Properties |
| Boiling point | 344.7±27.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 4.03±0.24(Predicted) | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C13H20BNO3/c1-6-16-11-10(8-7-9-15-11)14-17-12(2,3)13(4,5)18-14/h7-9H,6H2,1-5H3 | | InChIKey | GRXNEZGBXVIORK-UHFFFAOYSA-N | | SMILES | CCOc1ncccc1B2OC(C)(C)C(C)(C)O2 | | CAS DataBase Reference | 848243-23-2 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 2-Ethoxy-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine Usage And Synthesis |
| Synthesis | A suspension was prepared in DMSO (100 mL) with 3-bromo-2-ethoxypyridine (28.69 g, 142.0 mmol), bis(pinacolato)diboron (43.3 g, 170.5 mmol) and potassium acetate (41.8 g, 425.9 mmol). The suspension was degassed with nitrogen and [1,1'-bis(diphenylphosphino)ferrocene]dichloropalladium(II) (5.8 g, 7.93 mmol) was added. The reaction mixture was stirred at 95 °C for 6 hours. After completion of the reaction, the reaction mixture was filtered through an Arbocel pad and washed with ethyl acetate (500 mL). The filtrate was concentrated under vacuum and the crude product was purified by silica gel column chromatography using a 50% cyclohexane solution of ethyl acetate as eluent to afford 2-ethoxypyridine-3-boronic acid pinacol ester as a red oil (34.4 g, 74% yield).1H NMR (400 MHz, CDCl3) data were as follows: δ 1.35 (s, 12H), 1.39 (m, 3H). 4.37 (m, 2H), 6.81 (m, 1H), 7.89 (m, 1H), 8.19 (m, 1H).Results of LCMS analysis: retention time (Rt) = 3.27 min, mass spectrum (MS) m/z 250 [MH]+. | | References | [1] Patent: WO2013/93688, 2013, A1. Location in patent: Page/Page column 44-45 |
| | 2-Ethoxy-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine Preparation Products And Raw materials |
|