| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Basic information |
| Product Name: | 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | | Synonyms: | 2-ETHOXYPYRIDINE-5-BORONIC ACID, PINACOL ESTER;2-ethoxy-5-(tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine;Pyridine, 2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | | CAS: | 1072945-01-7 | | MF: | C13H20BNO3 | | MW: | 249.11 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical Properties |
| storage temp. | 2-8°C | | Appearance | White to light yellow Solid | | Water Solubility | Sparingly soluble in water (0.019 g/L) (25°C) | | InChI | 1S/C13H20BNO3/c1-6-16-11-8-7-10(9-15-11)14-17-12(2,3)13(4,5)18-14/h7-9H,6H2,1-5H3 | | InChIKey | GXUHWEZZHFBDFA-UHFFFAOYSA-N | | SMILES | B2(OC(C(O2)(C)C)(C)C)c1cnc(cc1)OCC |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Usage And Synthesis |
| Uses | 2-Ethoxypyridine-5-boronic acid pinacol ester is used as raw material for synthesis of pharmaceutical intermediates. |
| | 2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Preparation Products And Raw materials |
|