|
|
| | 3-(4-Propoxyphenyl)acrylic acid Basic information | | Uses |
| Product Name: | 3-(4-Propoxyphenyl)acrylic acid | | Synonyms: | RARECHEM BK HW 0039;TIMTEC-BB SBB002371;4-PROPOXYCINNAMIC ACID;(2E)-3-(4-Propoxyphenyl)acrylic acid;3-(4-Propoxyphenyl)acrylic acid, 3-(4-Propoxyphenyl)prop-2-enoic acid;(Z)-3-(4-propoxyphenyl)acrylic acid;(Z)-3-(4-propoxyphenyl)prop-2-enoic acid;4-PropoxycinnamicAcid> | | CAS: | 69033-81-4 | | MF: | C12H14O3 | | MW: | 206.24 | | EINECS: | | | Product Categories: | | | Mol File: | 69033-81-4.mol |  |
| | 3-(4-Propoxyphenyl)acrylic acid Chemical Properties |
| Melting point | 166.0 to 172.0 °C | | Boiling point | 364.8±17.0 °C(Predicted) | | density | 1.132±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.60±0.10(Predicted) | | InChI | InChI=1S/C12H14O3/c1-2-9-15-11-6-3-10(4-7-11)5-8-12(13)14/h3-8H,2,9H2,1H3,(H,13,14) | | InChIKey | WTYNDSOJMSGRQV-VMPITWQZSA-N | | SMILES | C(O)(=O)C=CC1=CC=C(OCCC)C=C1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2918999090 |
| | 3-(4-Propoxyphenyl)acrylic acid Usage And Synthesis |
| Uses | (E)-3-(4-propoxyphenyl)acrylic acid is a carboxylic acid derivative and can be used as fragrance. | | Uses | 4-Propoxycinnamic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | 3-(4-Propoxyphenyl)acrylic acid Preparation Products And Raw materials |
|