|
|
| | 4-Methylumbelliferyl-beta-D-glucuronide Basic information |
| | 4-Methylumbelliferyl-beta-D-glucuronide Chemical Properties |
| Melting point | 102 °C | | alpha | -105 º (c=0.25, water 30 ºC) | | Boiling point | 683.1±55.0 °C(Predicted) | | density | 1.632±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 2.76±0.70(Predicted) | | form | White crystalline solid | | color | White | | Water Solubility | slightly soluble | | Sensitive | Moisture Sensitive | | InChI | InChI=1/C16H16O9/c1-6-4-10(17)24-9-5-7(2-3-8(6)9)23-16-13(20)11(18)12(19)14(25-16)15(21)22/h2-5,11-14,16,18-20H,1H3,(H,21,22)/t11-,12-,13+,14-,16+/s3 | | InChIKey | ARQXEQLMMNGFDU-YXNYVWNSSA-N | | SMILES | CC1=CC(=O)OC2=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](C(=O)O)O3)O)=CC=C12 |&1:10,11,12,14,16,r| | | CAS DataBase Reference | 6160-80-1(CAS DataBase Reference) | | EPA Substance Registry System | .beta.-D-Glucopyranosiduronic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl (6160-80-1) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-40 | | Safety Statements | 24/25-36/37 | | WGK Germany | 3 | | TSCA | Yes | | HS Code | 29329990 |
| | 4-Methylumbelliferyl-beta-D-glucuronide Usage And Synthesis |
| Description | 4-Methylumbelliferyl-beta-D-glucuronide is a fluorescent substrate of β-glucuronidase. Once cleaved, 4-Methylumbelliferyl-beta-D-glucuronide yields blue fluorescence seen under UV light which is pH-dependent with excitation maxima of 320 and 360 nm at low (1.97-6.72) and high (7.12-10.3) pH, respectively. It is ideal for working with Escherichia coli and plant molecular studies. | | Chemical Properties | Crystalline | | Uses | 4-Methylumbelliferyl-beta-D-glucuronide is a substrate for glucuronidase. Also used as a test for coliform bacteria in water. Fluorescence: max. Abs. 316nm; max. Em. 375nm; e x 10-3: 12 | | Uses | Substrate for ?-D-glucuronidase assay. MUG is widely used as component of selective microbial culture media. | | Uses | 4-Methylumbelliferyl β-D-glucuronide dihydrate is a useful building block and a fluorophore. | | Definition | ChEBI: A beta-D-glucosiduronic acid having a 4-methylumbelliferyl substituent at the anomeric position. |
| | 4-Methylumbelliferyl-beta-D-glucuronide Preparation Products And Raw materials |
|