|
|
| | S-(Lactoyl)glutathione Basic information |
| | S-(Lactoyl)glutathione Chemical Properties |
| Boiling point | 770.516±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.469±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | −20°C | | form | powder | | pka | 2.212±0.10(predicted) | | color | white | | Major Application | detection | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C13H21N3O8S/c1-6(17)13(24)25-5-8(11(21)15-4-10(19)20)16-9(18)3-2-7(14)12(22)23/h6-8,17H,2-5,14H2,1H3,(H,15,21)(H,16,18)(H,19,20)(H,22,23)/t6-,7-,8-/m0/s1 | | InChIKey | VDYDCVUWILIYQF-FXQIFTODSA-N | | SMILES | C[C@H](O)C(=O)SC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | S-(Lactoyl)glutathione Usage And Synthesis |
| Uses | detection | | Biological Activity | S-Lactoylglutathione (SLG) is used to study the glutathione-dependent glyoxalase system and KefGB potassium efflux pump in bacteria and plants. S-Lactoylglutathione may also be used to study the inhibition of de novo pyrimidine synthesis in cancer. |
| | S-(Lactoyl)glutathione Preparation Products And Raw materials |
|