|
|
| | 2-NP-AOZ Basic information |
| Product Name: | 2-NP-AOZ | | Synonyms: | 3-(2-NITROBENZYLIDENAMINO)-2-OXAZOLIDINONE;3-[(E)-(2-nitrophenyl)methylideneamino]-2-oxazolidinone;2-NP-AOZ Solution, 100ppm;2-NITROBENZALDEHYDE DERIVATIVE OF 3-AMINO-2-OXAZOLIDONE;2-NP-AOZ;3-((2-nitrophenyl)methyleneamino)-2-oxazolidon;3-((o-nitrophenyl)methyleneamino)-2-oxazolidon;3-(o-nitrobenzylideneamino)-2-oxazolidon | | CAS: | 19687-73-1 | | MF: | C10H9N3O4 | | MW: | 235.2 | | EINECS: | | | Product Categories: | Heterocycles;Intermediates | | Mol File: | 19687-73-1.mol |  |
| | 2-NP-AOZ Chemical Properties |
| Melting point | 175-176℃ | | Boiling point | 380.8±44.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | pka | -1.38±0.20(Predicted) | | color | Pale Yellow to Dark Yellow | | Major Application | clinical testing | | InChI | 1S/C10H9N3O4/c14-10-12(5-6-17-10)11-7-8-3-1-2-4-9(8)13(15)16/h1-4,7H,5-6H2/b11-7+ | | InChIKey | OHYXOGZWSSNLON-YRNVUSSQSA-N | | SMILES | [O-][N+](=O)c1ccccc1\C=N\N2CCOC2=O |
| WGK Germany | 2 | | RTECS | RQ4225100 | | Storage Class | 11 - Combustible Solids |
| | 2-NP-AOZ Usage And Synthesis |
| Uses | A derivatized of 3-amino-2-oxazolidone (AOZ, A618570), a metabolite of Furazolidone and Nitrofuran. | | Uses | A derivative of 3-amino-2-oxazolidone (AOZ, A618570), a metabolite of Furazolidone and Nitrofuran.Environmental contaminants; Food contaminants; Heat processing contaminants |
| | 2-NP-AOZ Preparation Products And Raw materials |
|