2,2'-DICHLOROBENZIL manufacturers
- 2,2'-Dichlorobenzil
-
- $0.00 / 1Kg/Drum
-
2023-11-13
- CAS:21854-95-5
- Min. Order: 1Kg/Drum
- Purity: 99%
- Supply Ability: 500KG
- 2,2'-DICHLOROBENZIL
-
- $1.00 / 1KG
-
2020-01-05
- CAS:21854-95-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| | 2,2'-DICHLOROBENZIL Basic information |
| Product Name: | 2,2'-DICHLOROBENZIL | | Synonyms: | 2,2'-DICHLOROBENZIL;1,2-Bis(2-chlorophenyl)-1,2-ethanedione;2,2'-Dichlorodibenzoyl;Benzil, 2,2'-dichloro-;bis(2-chlorophenyl)-ethanedion;Ethanedione, bis(2-chlorophenyl)-;2,2'-DICHLORBENZIL, 97%;2,2''-DICHLOROBENZIL 98+% | | CAS: | 21854-95-5 | | MF: | C14H8Cl2O2 | | MW: | 279.12 | | EINECS: | 627-448-5 | | Product Categories: | C13 to C14;Carbonyl Compounds;Ketones | | Mol File: | 21854-95-5.mol |  |
| | 2,2'-DICHLOROBENZIL Chemical Properties |
| Melting point | 132-136 °C (lit.) | | Boiling point | 426.9±30.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | solid | | Appearance | Light yellow to green yellow Solid | | BRN | 2120689 | | InChI | InChI=1S/C14H8Cl2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8H | | InChIKey | VOSNNSVWVJFJCR-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1Cl)(=O)C(C1=CC=CC=C1Cl)=O | | CAS DataBase Reference | 21854-95-5 | | EPA Substance Registry System | Ethanedione, bis(2-chlorophenyl)- (21854-95-5) |
| Hazard Codes | Xi,N | | Risk Statements | 36-50/53 | | Safety Statements | 26-36-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Irrit. 2 |
| | 2,2'-DICHLOROBENZIL Usage And Synthesis |
| Uses | 1,2-Bis(2-chlorophenyl)-1,2-ethanedione is a key intermediate in the synthesis of substituted benzils and analogs with biological and pharmacological properties. |
| | 2,2'-DICHLOROBENZIL Preparation Products And Raw materials |
|