| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4,4'-Dichlorobenzil manufacturers
- 4,4-dichlorobenzil
-
- $16.00
-
2026-09-15
- CAS:3457-46-3
- Min. Order: 5g
- Purity: 0.99
- Supply Ability: 25kg
- 4,4'-Dichlorobenzil
-
- $1.00
-
2020-01-05
- CAS:3457-46-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| | 4,4'-Dichlorobenzil Basic information |
| Product Name: | 4,4'-Dichlorobenzil | | Synonyms: | 1,2-BIS(4-CHLOROPHENYL)-1,2-ETHANEDIONE;1,2-BIS-(4-CHLORO-PHENYL)-ETHANE-1,2-DIONE;bis(4-chlorophenyl)ethanedione;Bis(p-chlorophenyl)ethanedione;4,4'-Dichlorobibenzyl-α,β-dione;Bis(4-chlorophenyl) diketone;Di(4-chlorophenyl) diketone;p,p'-Dichlorobenzil | | CAS: | 3457-46-3 | | MF: | C14H8Cl2O2 | | MW: | 279.12 | | EINECS: | 222-387-7 | | Product Categories: | | | Mol File: | 3457-46-3.mol |  |
| | 4,4'-Dichlorobenzil Chemical Properties |
| Melting point | 194-197°C | | Boiling point | 220°C/3mmHg(lit.) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | λmax | 272nm(EtOH)(lit.) | | InChI | InChI=1S/C14H8Cl2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H | | InChIKey | XMAWUPHYEABFDR-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Cl)C=C1)(=O)C(C1=CC=C(Cl)C=C1)=O | | CAS DataBase Reference | 3457-46-3(CAS DataBase Reference) | | NIST Chemistry Reference | P-p'-dichloro-benzil(3457-46-3) | | EPA Substance Registry System | 4,4'-Dichlorobenzil (3457-46-3) |
| Hazard Codes | Xn | | TSCA | TSCA listed | | HS Code | 2917.39.7000 |
| | 4,4'-Dichlorobenzil Usage And Synthesis |
| Chemical Properties | White Crystal |
| | 4,4'-Dichlorobenzil Preparation Products And Raw materials |
|