|
|
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid ethyl ester Basic information |
| Product Name: | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid ethyl ester | | Synonyms: | 4-(4-Fluorophenyl)-3-oxobutanoic acid ethyl ester;Benzenebutanoic acid, 4-fluoro-β-oxo-, ethyl ester;Ethyl 4-fluorophenylacethylacetate;Ethyl 4- (4-fluorophenyl) -3-oxobutyrate;Ethyl 4-fluoro-β-oxobenzenebutanoate;4-(4-Fluoro-phenyl)-3-oxo-butyric acid ethyl ester | | CAS: | 221121-37-5 | | MF: | C12H13FO3 | | MW: | 224.23 | | EINECS: | | | Product Categories: | | | Mol File: | 221121-37-5.mol |  |
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid ethyl ester Chemical Properties |
| Boiling point | 295.5±20.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 10.35±0.46(Predicted) | | Appearance | yellow liquid | | InChI | InChI=1S/C12H13FO3/c1-2-16-12(15)8-11(14)7-9-3-5-10(13)6-4-9/h3-6H,2,7-8H2,1H3 | | InChIKey | QCQKQRINQDBSEZ-UHFFFAOYSA-N | | SMILES | C(C1C=CC(F)=CC=1)C(=O)CC(=O)OCC |
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid ethyl ester Usage And Synthesis |
| Uses | Ethyl 4-(4-Fluorophenyl)-3-oxobutanoate is used in the synthesis of novel pyridinone derivatives as non-nucleoside reverse transcriptase inhibitors with high potency against NNRTI-resistant HIV-1 strains. Also used in the structural evaluation of 2-substituted 5-hydroxyindole 3-carboxylates as potent inhibitors of human 5-lipoxygenase. |
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid ethyl ester Preparation Products And Raw materials |
|