|
|
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid methyl ester Basic information |
| Product Name: | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid methyl ester | | Synonyms: | 4-FLUORO-BETA-OXO-BENZENEBUTANOIC ACID METHYL ESTER;4-Fluoro-b-oxo-benzenebutanoic acid Methyl ester;4-(4-fluorophenyl)-3-oxobutanoic acid methyl ester;Benzenebutanoic acid, 4-fluoro-β-oxo-, methyl ester;Methyl 4-(4-fluorophenyl)-3-oxobutanoate;4-(4-Fluoro-phenyl)-3-oxo-butyric acid methyl ester | | CAS: | 500366-84-7 | | MF: | C11H11FO3 | | MW: | 210.2 | | EINECS: | | | Product Categories: | | | Mol File: | 500366-84-7.mol |  |
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid methyl ester Chemical Properties |
| InChI | InChI=1S/C11H11FO3/c1-15-11(14)7-10(13)6-8-2-4-9(12)5-3-8/h2-5H,6-7H2,1H3 | | InChIKey | OZELTQPRZKEBGN-UHFFFAOYSA-N | | SMILES | C(C(CC1=CC=C(C=C1)F)=O)C(OC)=O |
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid methyl ester Usage And Synthesis |
| | 4-(4-Fluoro-phenyl)-3-oxo-butyric acid methyl ester Preparation Products And Raw materials |
|