| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6 Basic information |
| Product Name: | m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6 | | Synonyms: | M-Xylene-d6;m-Xylene-α,α,α,α′,α′,α′-d6;m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6;m-Xylene-(dimethyl-d6);m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6;m-Xylene-[dimethyl-d6 | | CAS: | 29636-65-5 | | MF: | C8H10 | | MW: | 106.17 | | EINECS: | | | Product Categories: | | | Mol File: | 29636-65-5.mol |  |
| | m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6 Chemical Properties |
| Melting point | -48°C (lit.) | | Boiling point | 138-139°C (lit.) | | density | 0.916g/mL at 25°C | | InChI | 1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3/i1D3,2D3 | | InChIKey | IVSZLXZYQVIEFR-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])c1cccc(c1)C([2H])([2H])[2H] |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Flam. Liq. 3
Skin Irrit. 2 |
| | m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6 Usage And Synthesis |
| Uses | m-Xylene-alpha,alpha,alpha,alpha'',alpha'',alpha''-d6 (CAS# 29636-65-5) is a useful isotopically labeled research compound. |
| | m-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6 Preparation Products And Raw materials |
|