|
|
| | Hexamethylbenzene-d18 Basic information |
| | Hexamethylbenzene-d18 Chemical Properties |
| Melting point | 165-167 °C(lit.) | | solubility | Chloroform (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C12H18/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3 | | InChIKey | YUWFEBAXEOLKSG-NBDUPMGQSA-N | | SMILES | [2H]C([2H])([2H])c1c(c(c(c(c1C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 87-85-4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Hexamethylbenzene-d18 Usage And Synthesis |
| Uses | Hexamethylbenzene-d18 is the deuterium labeled Hexamethylbenzene[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110 |
| | Hexamethylbenzene-d18 Preparation Products And Raw materials |
|