| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | Sucrose 6'-monophosphate dipotassium salt Basic information |
| Product Name: | Sucrose 6'-monophosphate dipotassium salt | | Synonyms: | BETA-D-FRU-6-P-[2->1]-ALPHA-D-GLC DIPOTASSIUM SALT;sucrose-6'-monophosphate dipotassium;(3,4-Dihydroxy-5-(hydroxymethyl)-5-((3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2h-pyran-2-yl)oxy)tetrahydrofuran-2-yl)methyl dihydrogen phosphate, potassium salt;β-d-fru-6-p-(2→1)-α-d-glc;Sucrose 6'-monophosphate dipotassium salt | | CAS: | 36064-19-4 | | MF: | C12H21K2O14P | | MW: | 498.46 | | EINECS: | | | Product Categories: | | | Mol File: | 36064-19-4.mol |  |
| | Sucrose 6'-monophosphate dipotassium salt Chemical Properties |
| storage temp. | −20°C | | form | solid | | color | white | | InChI | 1S/C12H23O14P.K.H/c13-1-4-6(15)8(17)9(18)11(24-4)26-12(3-14)10(19)7(16)5(25-12)2-23-27(20,21)22;;/h4-11,13-19H,1-3H2,(H2,20,21,22);; | | InChIKey | HTUHVZMDNCZYMG-UHFFFAOYSA-N | | SMILES | [K].OCC1OC(OC2(CO)OC(COP(O)(O)=O)C(O)C2O)C(O)C(O)C1O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Sucrose 6'-monophosphate dipotassium salt Usage And Synthesis |
| Uses | Sucrose 6′-monophosphate (dipotassium) is a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | Sucrose 6'-monophosphate dipotassium salt Preparation Products And Raw materials |
|