| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | D-Fructose 6-phosphate dipotassium salt Basic information |
| | D-Fructose 6-phosphate dipotassium salt Chemical Properties |
| storage temp. | −20°C | | solubility | H2O: soluble100mg/mL, clear to slightly hazy, colorless to faintly yellow | | form | amorphous powder | | color | white to off-white | | InChI | 1S/C6H13O9P.2K/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13;;/h3-5,7-10H,1-2H2,(H2,11,12,13);;/q;2*+1/p-2/t3-,4-,5+,6;;/m1../s1 | | InChIKey | UNAFCPBHNZYEIY-UHOQFTJOSA-L | | SMILES | [K+].[K+].OCC1(O)O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@@H]1O |
| | D-Fructose 6-phosphate dipotassium salt Usage And Synthesis |
| Uses | D-Fructofuranose 6-(Dihydrogen phosphate) Dipotassium Salt is an impurity of D-Fructose(F792500). D-Fructose occurs naturally in a large number of fruits, honey, and plants. High intake and consumption of fructose has been hypothesized to increase occurrence of diabetes and insulin resistance. |
| | D-Fructose 6-phosphate dipotassium salt Preparation Products And Raw materials |
|