| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 4-Hydroxy-3-nitrobenzaldehyde Basic information |
| | 4-Hydroxy-3-nitrobenzaldehyde Chemical Properties |
| Melting point | 140-142 °C (lit.) | | Boiling point | 295.67°C (rough estimate) | | density | 1.5216 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | pka | 4.99±0.14(Predicted) | | color | light yellow | | Sensitive | Air Sensitive | | BRN | 2047884 | | Henry's Law Constant | 9.4×100 mol/(m3Pa) at 25℃, Schwarzenbach et al. (1988) | | InChI | InChI=1S/C7H5NO4/c9-4-5-1-2-7(10)6(3-5)8(11)12/h1-4,10H | | InChIKey | YTHJCZRFJGXPTL-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(O)C([N+]([O-])=O)=C1 | | CAS DataBase Reference | 3011-34-5(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Hydroxy-3-nitrobenzaldehyde(3011-34-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT, AIR SENSITIVE | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids |
| | 4-Hydroxy-3-nitrobenzaldehyde Usage And Synthesis |
| Chemical Properties | yellow-brown to brown powder | | Uses | 4-Hydroxy-3-nitrobenzaldehyde is an Intermediate used in synthesis of novel amodiaquine analogs as potential antimalarial and antifilarial compounds. | | Uses | 4-Hydroxy-3-nitrobenzaldehyde was used in the synthesis of:
- 4-hydroxy-3-nitrocinnamic acid
- solvated benzohydrazone derivatives: N′-(4-hydroxy-3-nitrobenzylidene)-3-methylbenzohydrazide-methanol-water
| | General Description | 4-Hydroxy-3-nitrobenzaldehyde reacts with 3-bromo-benzohydrazide in methanol to yield (E)-3-bromo-N′-(4-hydroxy-3-nitrobenzylidene)benzohydrazide. |
| | 4-Hydroxy-3-nitrobenzaldehyde Preparation Products And Raw materials |
|