| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-(+)-4-BENZYL-5,5-DIMETHYL-2-OXAZOLIDINONE Basic information |
| Product Name: | (R)-(+)-4-BENZYL-5,5-DIMETHYL-2-OXAZOLIDINONE | | Synonyms: | (R)-(+)-4-BENZYL-5,5-DIMETHYL-2-OXAZOLIDINONE;(R)-(+)-4-BENZYL-5,5-DIMETHYL-2-OXAZOL-I DINONE, 98% (99% EE/HPLC);2-Oxazolidinone,5,5-dimethyl-4-(phenylmethyl)-,(4R)-(9CI);(R)-(+)-4-Benzyl-5,5-diMethyl-2-oxazolidinone,98%;(R)-4-Benzyl-5,5-dimethyl-2-oxazolidinone,99%e.e.;(4R)-4-benzyl-5,5-dimethyl-1,3-oxazolidin-2-one;2-Oxazolidinone, 5,5-dimethyl-4-(phenylmethyl)-, (4R)-;(R)-(+)-4-Benzyl-5,5-dimethyl-2-oxazolidinone 98% | | CAS: | 204851-73-0 | | MF: | C12H15NO2 | | MW: | 205.25 | | EINECS: | | | Product Categories: | N-BOC;Asymmetric Synthesis;Chiral Auxiliaries;Oxazolidinone Derivatives | | Mol File: | 204851-73-0.mol |  |
| | (R)-(+)-4-BENZYL-5,5-DIMETHYL-2-OXAZOLIDINONE Chemical Properties |
| Melting point | 60-62 °C(lit.) | | Boiling point | 385.0±9.0 °C(Predicted) | | density | 1.085±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 12.86±0.60(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D +96°, c = 2 in chloroform | | InChI | 1S/C12H15NO2/c1-12(2)10(13-11(14)15-12)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,13,14)/t10-/m1/s1 | | InChIKey | AEEGFEJKONZGOH-SNVBAGLBSA-N | | SMILES | CC1(C)OC(=O)N[C@@H]1Cc2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(+)-4-BENZYL-5,5-DIMETHYL-2-OXAZOLIDINONE Usage And Synthesis |
| Uses | Versatile chiral auxiliary for asymmetric synthesis used in diastereoselective Michael additions. |
| | (R)-(+)-4-BENZYL-5,5-DIMETHYL-2-OXAZOLIDINONE Preparation Products And Raw materials |
|