| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Silver p-toluenesulfonate Basic information |
| Product Name: | Silver p-toluenesulfonate | | Synonyms: | P-TOLUENESULFONIC ACID SILVER SALT;SILVER TOLUENE-4-SULFONATE;SILVER 4-TOLUENESULFONATE;SILVER(I) P-TOLUENESULFONATE;SILVER(I) P-TOLUENESULPHONATE;TOLUENE-4-SULFONIC ACID SILVER SALT;4-methyl-benzenesulfonicacisilver(1++)salt;4-TOLUENESULFONIC ACID SILVER SALT | | CAS: | 16836-95-6 | | MF: | C7H7AgO3S | | MW: | 279.06 | | EINECS: | 240-859-0 | | Product Categories: | Ag | | Mol File: | 16836-95-6.mol |  |
| | Silver p-toluenesulfonate Chemical Properties |
| Melting point | 264-266℃ (decomposition) | | storage temp. | Store below +30°C. | | solubility | sol acetonitrile, diethyl ether, water | | form | powder | | Appearance | White Powder | | Water Solubility | Soluble in water. | | Sensitive | Light Sensitive | | BRN | 3598937 | | Major Application | PEM fuel cells
material synthesis precursor | | InChI | 1S/C7H8O3S.Ag/c1-6-2-4-7(5-3-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1 | | InChIKey | JUDUFOKGIZUSFP-UHFFFAOYSA-M | | SMILES | [Ag+].Cc1ccc(cc1)S([O-])(=O)=O | | CAS DataBase Reference | 16836-95-6(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 4-methyl-, silver(1+) salt (16836-95-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | HazardClass | 9 | | HS Code | 2843290000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Silver p-toluenesulfonate Usage And Synthesis |
| Chemical Properties | WHITE TO LIGHT GREY CRYSTALLINE POWDER | | Uses | Silver p-toluenesulfonate is used to converts alkyl halides to tosylates, and benzyl selenyl chlorides into their corresponding selenyl tosylates. It used in promotion of the leaving ability of halogens. For use in the conversion of alkyl halides to alkyl tosylates. | | Preparation | Silver p-toluenesulfonate can be prepared by mixing aqueous solutions of Silver(I) Nitrate and sodium tosylate and filtering off the precipitate. | | reaction suitability | reagent type: catalyst
core: silver | | storage | Silver p-toluenesulfonate should be protected from light. | | Purification Methods | The anhydrous salt is obtained by recrystallisation from H2O. Store it in the dark. [Claesson & Wallin Chem Ber 12 1851 1879, Beilstein 11 H 97, 99.] |
| | Silver p-toluenesulfonate Preparation Products And Raw materials |
|