|
|
| | 08:0 PE Basic information |
| Product Name: | 08:0 PE | | Synonyms: | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octanoyloxypropyl] octanoate;1,2-DIOCTANOYL-SN-GLYCERO-3-PHOSPHOETHANOLAMINE;08:0 PE;1,2-DIOCTANOYL-SN-GLYCERO-3-PHOSPHOETHANOLAMINE;08:0 PE;Octanoic acid, 1,1'-[(1R)-1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl] ester;1,2-Dioctanoyl-sn-glycero-phosphoethanolamine;(2R)-3-(((2-Aminoethoxy)(hydroxy)phosphoryl)oxy)propane-1,2-diyl dioctanoate | | CAS: | 96760-44-0 | | MF: | C21H42NO8P | | MW: | 467.53 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 08:0 PE Chemical Properties |
| Boiling point | 562.392±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.112±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | form | powder | | pka | 1.102±0.50(predicted) | | InChIKey | UNACBKDVIYEXSL-LJQANCHMSA-N | | SMILES | [H][C@@](COP([O-])(OCC[NH3+])=O)(OC(CCCCCCC)=O)COC(CCCCCCC)=O |
| Storage Class | 11 - Combustible Solids |
| | 08:0 PE Usage And Synthesis |
| Uses | 1,2-Dioctanoyl-sn-glycero-phosphoethanolamine is used as drug dosage form of phenylcarbamoylaminobenzoates for enhancing cell survival rate. | | Definition | ChEBI: PE(8:0/8:0) is a 1,2-diacyl-sn-glycero-3-phosphoethanolamine. | | Biological Activity | Phosphatidylethanolamine (PE) plays a vital role in the structure and function of eukaryotic membranes. It serves as a lipid chaperon. It is known to participate in the initiation of autophagy. The hexagonal phase of PE is involved in membrane fusion events. |
| | 08:0 PE Preparation Products And Raw materials |
|