- Granisetron-D3
-
- $747.00
-
2026-05-11
- CAS:1224925-76-1
- Purity:
- Supply Ability: 10g
- Granisetron D3
-
- $123000.00
-
2023-05-27
- CAS:1224925-76-1
- Min. Order: 10mg
- Purity: 96%
- Supply Ability: 100
|
| | Granisetron hydrochloride Basic information |
| | Granisetron hydrochloride Chemical Properties |
| Melting point | 290-292°C | | Boiling point | 532.016±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.330±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.341±0.20(predicted) | | color | White to Off-White | | InChI | InChI=1/C18H24N4O/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23)/t12-,13+,14-/i2D3 | | InChIKey | MFWNKCLOYSRHCJ-JQHPXDLNNA-N | | SMILES | C1(C(=O)N[C@H]2C[C@@]3([H])CCC[C@@](N3C)([H])C2)C2C=CC=CC=2N(C([2H])([2H])[2H])N=1 |&1:4,6,11,r| | | CAS DataBase Reference | 1224925-76-1 |
| | Granisetron hydrochloride Usage And Synthesis |
| Description | Granisetron-d3 is intended for use as an internal standard for the quantification of granisetron by GC- or LC-MS. Granisetron is an antagonist of the serotonin (5-HT) receptor subtype 5-HT3 (Ki = 3.9 nM) with antiemetic activity. | | Chemical Properties | White to Off-White Crystalline Sold | | Uses | GRANISETRON-D3 is a specific serotonin (5HT3) receptor antagonist,it is Used as an antiemetic. | | Uses | Granisetron-d3 is the labeled analogue of Granisetron (G780000), a specific serotonin (5HT3) receptor antagonist. Used as an antiemetic. |
| | Granisetron hydrochloride Preparation Products And Raw materials |
|