| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:4-Chlorobenzaldehyde-2,3,5,6-d4 CAS:62285-59-0 Package:100Mg,10Mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:4-Chlorobenzaldehyde--d4 CAS:62285-59-0 Remarks:CS-C-01848
|
| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:4-Chlorobenzaldehyde-2,3,5,6-d4 CAS:62285-59-0 Remarks:CS-T-50466
|
| Company Name: |
Shanghai Jizhi Biochemical Technology Co. Ltd.
|
| Tel: |
021-4009004166/18616739031 18616739031 |
| Email: |
3007523370@qq.com |
| Products Intro: |
Product Name:4-Chlorobenzaldehyde-2,3,5,6-d4 CAS:62285-59-0 Purity:99% Package:100mg Remarks:C40410
|
|
| | 4-CHLOROBENZALDEHYDE-2,3,5,6-D4 Basic information |
| Product Name: | 4-CHLOROBENZALDEHYDE-2,3,5,6-D4 | | Synonyms: | 4-CHLOROBENZALDEHYDE-2,3,5,6-D4;4-CHLOROBENZALDEHYDE-2,3,5,6-D4, 98 ATOM % D;4-Chlorobenzaldehyde--d4;4-Chlorobenzaldehyde-2,3,5,6-d4 | | CAS: | 62285-59-0 | | MF: | C7HClD4O | | MW: | 144.59 | | EINECS: | | | Product Categories: | Aromatics;Isotope Labelled Compounds;Alphabetical Listings;Biomolecular MS;Chemical Labeling Products;CStable Isotopes;Stable Isotopes | | Mol File: | 62285-59-0.mol |  |
| | 4-CHLOROBENZALDEHYDE-2,3,5,6-D4 Chemical Properties |
| Melting point | 45-50 °C(lit.) | | Boiling point | 213-214 °C(lit.) | | Fp | 87°C | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C7H5ClO/c8-7-3-1-6(5-9)2-4-7/h1-5H/i1D,2D,3D,4D | | InChIKey | AVPYQKSLYISFPO-RHQRLBAQSA-N | | SMILES | [H]C(=O)c1c([2H])c([2H])c(Cl)c([2H])c1[2H] |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39-36 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-CHLOROBENZALDEHYDE-2,3,5,6-D4 Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 4-Chlorobenzaldehyde-2,3,5,6-d4 (cas# 62285-59-0) is a compound useful in organic synthesis. |
| | 4-CHLOROBENZALDEHYDE-2,3,5,6-D4 Preparation Products And Raw materials |
|