|
|
| | 4'-Chloroacetophenone-2',3',5',6'-d4 Basic information |
| Product Name: | 4'-Chloroacetophenone-2',3',5',6'-d4 | | Synonyms: | 4-CHLOROACETOPHENONE-2,3,5,6-D4;4'-CHLOROACETOPHENONE-2',3',5',6'-D4, 98 ATOM % D;4'-Chloroacetophenone--d4;4'-Chloroacetophenone-2',3',5',6'-d4;4′-Chloroacetophenone-2′,3′,5′,6′-d4 | | CAS: | 284474-50-6 | | MF: | C8H7ClO | | MW: | 154.59 | | EINECS: | | | Product Categories: | Alphabetical Listings;C;Stable Isotopes | | Mol File: | 284474-50-6.mol |  |
| | 4'-Chloroacetophenone-2',3',5',6'-d4 Chemical Properties |
| Melting point | 14-18 °C(lit.) | | Boiling point | 232 °C(lit.) | | density | 1.192 g/mL at 25 °C | | refractive index | n20/D 1.5549(lit.) | | Fp | 194 °F | | InChI | 1S/C8H7ClO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3/i2D,3D,4D,5D | | InChIKey | BUZYGTVTZYSBCU-QFFDRWTDSA-N | | SMILES | [2H]c1c([2H])c(c([2H])c([2H])c1Cl)C(C)=O |
| Hazard Codes | Xn,T+ | | Risk Statements | 22-36/37/38-41-37/38-26 | | Safety Statements | 26-27-36/37/39-45-28 | | RIDADR | UN 3416 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4'-Chloroacetophenone-2',3',5',6'-d4 Usage And Synthesis |
| Uses | 4''-Chloroacetophenone-2'',3'',5'',6''-d4 (CAS# 284474-50-6) is a useful isotopically labeled research compound. |
| | 4'-Chloroacetophenone-2',3',5',6'-d4 Preparation Products And Raw materials |
|