- MQAE
-
- $36.00
-
2026-07-17
- CAS:162558-52-3
- Purity: 99.84%
- Supply Ability: 10g
|
| Product Name: | MQAE | | Synonyms: | MQAE BR;(6-METHOXYQUINOLINIO)ACETIC ACID ETHYL ESTER BROMIDE;6-METHOXYQUINOLINIUM-1-ACETIC ACID ETHYL ESTER BROMIDE SALT;1-(ETHOXYCARBONYLMETHYL)-6-METHOXYQUINOLINIUM (MQAE);MQAE, >99%;1-(2-Ethoxy-2-oxoethyl)-6-methoxyquinolin-1-ium bromide;N-(Ethoxycarbonylmethyl)-6-methoxyquinolinium bromide (MQAE);6-METHOXYQUINOLINIUM-1-ACETIC ACID*ETHYL ESTER BROM | | CAS: | 162558-52-3 | | MF: | C14H16BrNO3 | | MW: | 326.19 | | EINECS: | | | Product Categories: | Quinoline | | Mol File: | 162558-52-3.mol |  |
| Melting point | 177-179 °C(lit.) | | storage temp. | 2-8°C | | solubility | DMSO: soluble | | form | powder | | color | White | | Appearance | Pale Yellow Solid | | λmax | 350 nm | | Biological Applications | Chloride indicator; diagnosis of diseases caused by elemental imbalances; detecting cancer cells,spores,stress biomarkers | | InChI | 1S/C14H16NO3.BrH/c1-3-18-14(16)10-15-8-4-5-11-9-12(17-2)6-7-13(11)15;/h4-9H,3,10H2,1-2H3;1H/q+1;/p-1 | | InChIKey | DSLLHVISNOIYHR-UHFFFAOYSA-M | | SMILES | [Br-].CCOC(=O)C[n+]1cccc2cc(OC)ccc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-8-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Description | 1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium (bromide) is a fluorescent indicator dye that can be used to measure intracellular and extracellular chloride concentrations (absorption/emission max: 350/460 nm). It detects the ion via diffusion-limited collisional quenching. | | Uses | Improved chloride probe. Used to measure chloride transport in liposome membranes. | | Uses | Fluorescent Chloride indicator | | Uses | MQAE is a fluorescent indicator dye that can be used to measure intracellular and extracellular chloride concentrations (absorption/emission max: 350/460 nm). It detects the ion via diffusion-limited collisional quenching. | | References | [1] WAINWRIGHT M. Handbook of Biological Dyes and Stains – Synthesis and Industrial Applications[J]. Biotechnic & Histochemistry, 2011, 86 1: 444-445. DOI: 10.3109/10520295.2010.527301 |
| | MQAE Preparation Products And Raw materials |
|