| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
TSQ manufacturers
- TSQ
-
- $30.00
-
2026-09-12
- CAS:109628-27-5
- Purity: 99.69%
- Supply Ability: 10g
|
| Product Name: | TSQ | | Synonyms: | n-(6-methoxy-8-quinolyl)-4-toluenesulfonamide;(N-6-METHOXY-8-QUINOLINYL)-4-METHYLBENZENE SULFONAMIDE;N-(6-METHOXY-8-QUINOLYL)-P-TOLUENESULFONAMIDE;TSQ;P-toluenesulfonamide,n-(6-methoxy-8-quinolyl)-;Nsc 120213;N-(6-methoxyquinolin-8-yl)-4-methylbenzenesulfonamide;Benzenesulfonamide, N-(6-methoxy-8-quinolinyl)-4-methyl- | | CAS: | 109628-27-5 | | MF: | C17H16N2O3S | | MW: | 328.39 | | EINECS: | | | Product Categories: | Quinoline | | Mol File: | 109628-27-5.mol |  |
| Melting point | 133–134 ℃ | | storage temp. | -20°C Freezer | | solubility | Soluble in ethanol, methanol | | form | crystals | | color | White | | λmax | 334 nm | | Biological Applications | Zinc indicator; early diagnosis of prostate cancer; treating age-related macular degeneration (AMD),amyloidosis disorders,autoimmune diseases,herpes virus infection | | InChI | 1S/C17H16N2O3S/c1-12-5-7-15(8-6-12)23(20,21)19-16-11-14(22-2)10-13-4-3-9-18-17(13)16/h3-11,19H,1-2H3 | | InChIKey | HKRNYOZJJMFDBV-UHFFFAOYSA-N | | SMILES | O=S(C1=CC=C(C)C=C1)(NC2=C3C(C=CC=N3)=CC(OC)=C2)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| Description | N-(6-Methoxy-8-Quinolyl)-p-Toluenesulfonamide is a membrane-permeant Zn2+ indicator. | | Uses | Determn of extracellular and intracellular Zn2+ levels in biological systems. | | Uses | Zn+ selective probe in the presence of Mg+ and Ca+. | | Biochem/physiol Actions | TSQ (6-methoxy-8-p-toluenesulfonamido-quinoline) is a cell penetrant and specific fluorescent zinc sensor that preferentially accumulates in islet cells in a zinc content dependent manner. TSQ is commonly used to assess isolated islet purity. | | Excitation / Emission Maximum | 565 nm/590 nm |
| | TSQ Preparation Products And Raw materials |
|