| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
CiVentiChem |
| Tel: |
(919) 678-0702 ext. 227 |
| Email: |
debra@cvchem.com |
|
| | t-Butyl-4-N-Z-amino-2-fluoro-benzoate Basic information |
| | t-Butyl-4-N-Z-amino-2-fluoro-benzoate Chemical Properties |
| Boiling point | 428.6±45.0 °C(Predicted) | | density | 1.227±0.06 g/cm3(Predicted) | | pka | 12.44±0.70(Predicted) | | form | solid | | InChI | 1S/C19H20FNO4/c1-19(2,3)25-17(22)15-10-9-14(11-16(15)20)21-18(23)24-12-13-7-5-4-6-8-13/h4-11H,12H2,1-3H3,(H,21,23) | | InChIKey | RHKMSCPBEQGOLG-UHFFFAOYSA-N | | SMILES | CC(OC(C1=CC=C(C=C=1F)NC(OCC2=CC=CC=C2)=O)=O)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | t-Butyl-4-N-Z-amino-2-fluoro-benzoate Usage And Synthesis |
| | t-Butyl-4-N-Z-amino-2-fluoro-benzoate Preparation Products And Raw materials |
|