|
|
| | 4-(phenylmethoxycarbonylamino)benzoic acid Basic information |
| Product Name: | 4-(phenylmethoxycarbonylamino)benzoic acid | | Synonyms: | 4-(phenylmethoxycarbonylamino)benzoic acid;4-(Cbz-amino)benzoic acid;Benzoic acid, 4-[[(phenylmethoxy)carbonyl]amino]- (9CI);Benzoic acid, 4-[[(phenylmethoxy)carbonyl]amino]-;4-(Carbobenzoxyamino)benzoic acid | | CAS: | 5330-71-2 | | MF: | C15H13NO4 | | MW: | 271.27 | | EINECS: | | | Product Categories: | N-CBZ | | Mol File: | 5330-71-2.mol |  |
| | 4-(phenylmethoxycarbonylamino)benzoic acid Chemical Properties |
| Melting point | 217 °C (decomp) | | Boiling point | 425.1±38.0 °C(Predicted) | | density | 1.342±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.32±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C15H13NO4/c17-14(18)12-6-8-13(9-7-12)16-15(19)20-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,16,19)(H,17,18) | | InChIKey | XRKLFEVNZWRMCT-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(NC(OCC2=CC=CC=C2)=O)C=C1 |
| | 4-(phenylmethoxycarbonylamino)benzoic acid Usage And Synthesis |
| | 4-(phenylmethoxycarbonylamino)benzoic acid Preparation Products And Raw materials |
|