|
|
| | BMK methyl glycidate Basic information |
| Product Name: | BMK methyl glycidate | | Synonyms: | methyl-2-methyl-3-phenylglycidate;BMK methyl glycidate;2,3-EPOXY-2-METHYL-3-PHENYL-PROPIONSAEURE-METHYLESTER;BMK Powder glycidate;2-Oxiranecarboxylic acid, 2-methyl-3-phenyl-, methyl ester;methyl-2-methyl-3-phenylglycidate Basic information;Bmk Methyl-2-Methyl-3-Phenylglycidate;BMK Powder glycidate methyl-2-methyl-3-phenylglycidate | | CAS: | 80532-66-7 | | MF: | C11H12O3 | | MW: | 192.21 | | EINECS: | 205-854-1 | | Product Categories: | pharmaceutical | | Mol File: | 80532-66-7.mol |  |
| | BMK methyl glycidate Chemical Properties |
| Boiling point | 73-74 °C(Press: 0.2 Torr) | | density | 1.168±0.06 g/cm3(Predicted) | | solubility | DMF: 20 mg/ml; DMSO: 25 mg/ml; Ethanol: 20 mg/ml; PBS (pH 7.2): 1 mg/ml | | InChI | InChI=1S/C11H12O3/c1-11(10(12)13-2)9(14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3 | | InChIKey | CPPPKJUXIISPJL-UHFFFAOYSA-N | | SMILES | O1C(C2=CC=CC=C2)C1(C)C(OC)=O |
| | BMK methyl glycidate Usage And Synthesis |
| Description | BMK methyl glycidate is an analytical reference standard categorized as a precursor in the synthesis of phenylacetone.This product is intended for research and forensic applications. | | Description | BMK methyl glycidate (Item No. 9002714) is an analytical reference standard categorized as a precursor in the synthesis of phenylacetone (Item Nos. 16103 | 16444). This product is intended for research and forensic applications. | | Uses | 2‐methyl-3-phenyloxirane-2- carboxylic acid (BMK glycidic acid) is substances that is immediate precursors of amphetamines and that is frequently used for the illicit manufacture of amphetamines. | | Toxicology | Acute toxicity:
Oral LD50 6,482 mg/kg (rat)
Inhalative LC50/4 h >49.2 mg/l (rabbit) | | References | [1] R. A. KUROYAN. ChemInform Abstract: GENERAL CHARACTERISTICS OF OXIRANE RING OPENING DURING CLEAVAGE OF GLYCIDIC ACIDS[J]. ChemInform, 1984, 15 2. DOI: 10.1002/chin.198402096 |
| | BMK methyl glycidate Preparation Products And Raw materials |
|