DI-TERT-BUTYL PHOSPHITE manufacturers
- DI-TERT-BUTYL PHOSPHITE
-
- $1.10 / 1g
-
2025-06-25
- CAS:13086-84-5
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
- DI-TERT-BUTYL PHOSPHITE
-
- $15.00 / 1KG
-
2021-07-02
- CAS:13086-84-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | DI-TERT-BUTYL PHOSPHITE Basic information |
| Product Name: | DI-TERT-BUTYL PHOSPHITE | | Synonyms: | DI-TERT-BUTYL PHOSPHITE;Di(tert-butyl) hydrogen phosphite;di-t-Butyl phosphite;Phosphonic acid, bis(1,1-dimethylethyl) ester;Phosphorous acid di-tert-butyl ester;bis(1,1-dimethylethyl) phosphonate;Phosphonic acid di-tert-butyl ester;Einecs 235-996-8 | | CAS: | 13086-84-5 | | MF: | C8H19O3P | | MW: | 194.21 | | EINECS: | 235-996-8 | | Product Categories: | | | Mol File: | 13086-84-5.mol |  |
| | DI-TERT-BUTYL PHOSPHITE Chemical Properties |
| Melting point | >235 °C (decomp)(Solv: hexane (110-54-3)) | | Boiling point | Value: 62-62.5 °C | Condition: Press: 4 Torr | | density | 0.995 | | refractive index | 1.4200 | | Fp | 66-68°C/0.5mm | | storage temp. | 2-8°C | | solubility | Soluble in organic solvents | | form | Liquid | | Specific Gravity | 0.995 | | color | Colorless to Almost colorless | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/C8H19O3P/c1-7(2,3)10-12(9)11-8(4,5)6/h12H,1-6H3 | | InChIKey | RRJHOMPUEYYASJ-UHFFFAOYSA-N | | SMILES | P(=O)(OC(C)(C)C)OC(C)(C)C | | CAS DataBase Reference | 13086-84-5 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8 / PGIII | | WGK Germany | 3 | | PackingGroup | III | | HS Code | 29209090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B
Skin Sens. 1B |
| Provider | Language |
|
ALFA
| English |
| | DI-TERT-BUTYL PHOSPHITE Usage And Synthesis |
| Chemical Properties | Yellow liquid | | Uses | Di-tert-butyl phosphite is used as a solvent, as an antioxidant, and as an intermediate. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | DI-TERT-BUTYL PHOSPHITE Preparation Products And Raw materials |
|