| Company Name: |
Creative Enzymes |
| Tel: |
1-516-855-7709 |
| Email: |
info@creative-enzymes.com |
|
| | 7Β,25-DIHYDROXYCHOLESTEROL Basic information |
| | 7Β,25-DIHYDROXYCHOLESTEROL Chemical Properties |
| Boiling point | 548.5±35.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | pka | 14.11±0.70(Predicted) | | color | White to off-white | | InChIKey | BQMSKLCEWBSPPY-LVQATTALSA-N | | SMILES | CC1(CC[C@H](O)C2)C2=C[C@H](O)C3C1CCC4(C)C3CCC4C(CCCC(C)(O)C)C |
| Storage Class | 11 - Combustible Solids |
| | 7Β,25-DIHYDROXYCHOLESTEROL Usage And Synthesis |
| Uses | 7β,25-Dihydroxycholesterol is a potent and selective agonist of EB12. This compound can be used as a drug delivery system containing oxidized cholesterol. | | Definition | ChEBI: 7beta,25-dihydroxycholesterol is a 7beta-hydroxy steroid, a cholestanoid, an oxysterol and a 3beta-hydroxy-Delta(5)-steroid. | | Biological Activity | 7β,25-dihydroxycholesterol is an Epstein-Barr virus-induced gene 2 (EBI2) ligand and is comparatively a weaker chemoattractant than 7α,25-dihydroxycholesterol (7α25OHC). |
| | 7Β,25-DIHYDROXYCHOLESTEROL Preparation Products And Raw materials |
|