7,27-dihydroxycholesterol manufacturers
|
| | 7,27-dihydroxycholesterol Basic information |
| Product Name: | 7,27-dihydroxycholesterol | | Synonyms: | 7,27-dihydroxycholesterol;7ss,27-dihydroxycholesterol;Cholest-5-ene-3,7,26-triol, (3β,7β,25R)-;(3β,7β,25R)-Cholest-5-ene-3,7,26-triol;Cholesterol Impurity 36;27-DHC;7β;7β,27-dihydroxy Cholesterol | | CAS: | 240129-43-5 | | MF: | C27H46O3 | | MW: | 418.65 | | EINECS: | | | Product Categories: | | | Mol File: | 240129-43-5.mol |  |
| | 7,27-dihydroxycholesterol Chemical Properties |
| Boiling point | 552.622±35.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.083±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 2 mg/ml,Ethanol: 20 mg/ml,Ethanol:PBS (pH 7.2) (1:2): 0.30 mg/ml | | form | A crystalline solid | | pka | 14.106±0.70(predicted) | | color | White to off-white | | InChIKey | RXMHNAKZMGJANZ-BMOLSTJGSA-N | | SMILES | [H][C@@]12[C@]([C@](CC[C@H](O)C3)(C)C3=C[C@@H]2O)([H])CC[C@@]4(C)[C@@]1([H])CC[C@]4([H])[C@]([H])(C)CCC[C@@H](C)CO |
| Storage Class | 11 - Combustible Solids |
| | 7,27-dihydroxycholesterol Usage And Synthesis |
| Uses | (3β,7β,25R)-Cholest-5-ene-3,7,26-triol is a steroid derivative is used as an important signaling molecule. Oxygenated derivative of cholesterol. | | Definition | ChEBI: 7beta,27-dihydroxycholesterol is a bile acid. | | Biological Activity | 7β,27-dihydroxycholesterol (7β27OHC) is a retinoid-related orphan receptor γ (RORγ) ligand. 7β27OHC favors smoothened (Smo) functionality. | | in vivo | 7,27-Dihydroxycholesterol (60 mg/kg; s.c.; twice daily for 3 d) induces IL-17 production in mice in vivo[1]. | | IC 50 | RORγt: 120 nM (Ki) |
| | 7,27-dihydroxycholesterol Preparation Products And Raw materials |
|