|
|
| | L-(+)-MANDELIC ACID BENZYL ESTER Basic information |
| | L-(+)-MANDELIC ACID BENZYL ESTER Chemical Properties |
| Melting point | 107 °C | | Boiling point | 386.8±27.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | refractive index | 34 ° (C=1, CH3CN) | | storage temp. | Storage temp. 2-8°C | | form | powder to crystal | | pka | 12.15±0.20(Predicted) | | color | White to Almost white | | Optical Rotation | [α]25/D +55°, c = 1 in chloroform | | InChI | 1S/C15H14O3/c16-14(13-9-5-2-6-10-13)15(17)18-11-12-7-3-1-4-8-12/h1-10,14,16H,11H2/t14-/m0/s1 | | InChIKey | JFKWZVQEMSKSBU-AWEZNQCLSA-N | | SMILES | O[C@H](C(=O)OCc1ccccc1)c2ccccc2 | | CAS DataBase Reference | 62173-99-3 |
| WGK Germany | 3 | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids |
| | L-(+)-MANDELIC ACID BENZYL ESTER Usage And Synthesis |
| Uses | Benzyl (S)-(+)-mandelate can be used as a reactant to prepare:
- α-Hydroxy-N-(2-phenylethyl)benzenepropanamide by reacting with benzeneethanamine.
- Benzyl-2-fluoro-2-phenylacetate by deoxyfluorination of alcohols.
|
| | L-(+)-MANDELIC ACID BENZYL ESTER Preparation Products And Raw materials |
|