| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl mandelate Basic information |
| Product Name: | Ethyl mandelate | | Synonyms: | Phenylhydroxyacetic acid ethyl ester;α-Hydroxybenzeneacetic acid ethyl ester;Ethyl DL-mandelate,97%;Benzeneacetic acid, a-hydroxy-, ethyl ester;ETHYL MANDELATE FOR SYNTHESIS;Ethyl DL-Mandelate;MANDELIC ACID ETHYL ESTER;ETHYL PHENYLGLYCOLATE | | CAS: | 774-40-3 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | 212-263-0 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 774-40-3.mol |  |
| | Ethyl mandelate Chemical Properties |
| Melting point | 37 °C | | Boiling point | 253-255 °C(lit.) | | density | 1.115 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.512(lit.) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | solubility | soluble in Methanol | | pka | 12.33±0.20(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | FreezingPoint | 23.0 to 27.0 ℃ | | InChI | InChI=1S/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3 | | InChIKey | SAXHIDRUJXPDOD-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(C1=CC=CC=C1)O | | CAS DataBase Reference | 774-40-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 37/39-26 | | WGK Germany | 2 | | RTECS | OO7397000 | | HS Code | 2918 19 98 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 |
| | Ethyl mandelate Usage And Synthesis |
| Chemical Properties | clear colorless to yellowish liquid after melting | | Uses | Ethyl Mandelate is used as a reagent in the synthesis of several organic compounds including that of volatile methylsiloxanes which have the potential to be a more environmentally sustainable alternative as solvents in chemical synthesis to non-polar organic solvents. It was found to act as a substrate for (S)-mandelate dehydrogenase which is a flavin mononucleotide dependent enzyme that oxidises (S)-mandelate to benzoylformate. | | Definition | ChEBI: The ethyl ester of mandelic acid. |
| | Ethyl mandelate Preparation Products And Raw materials |
|