| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| Product Name: | NOR-3 | | Synonyms: | NOR-3;4-ETHYL2-E-(HYDROXYIMINO)-5-NITRO-3E-HEXENAMIDE;FK409;(+/-)-(E)-ETHYL-2-[(E)-HYDROXYIMINO]-5-NITRO-3-HEXENEAMIDE;(+/-)-(E)-4-ETHYL-2-[(E)-HYDROXYIMINO]-5-NITRO-3-HEXENAMIDE;(+/-)-(E)-4-Ethyl-2-[(E)-hydroxyimino]-5-nitro-3-hexeneamide (NOR 3);3-Hexenamide, 4-ethyl-2-(hydroxyimino)-5-nitro-, (2E,3E)-;(±)-(E)-4-Ethyl-2-[(E)-hydroxyimino]-5-nitro-3-hexenamide | | CAS: | 138472-01-2 | | MF: | C8H13N3O4 | | MW: | 215.21 | | EINECS: | | | Product Categories: | | | Mol File: | 138472-01-2.mol |  |
| | NOR-3 Chemical Properties |
| Boiling point | 428.169±47.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.336±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | −20°C | | solubility | DMF: >34 mg/ml; DMSO: >20 mg/ml; Ethanol: >36 mg/ml; PBS pH 7.2: >2.2 mg/ml | | form | White to off-white crystalline solid. | | pka | 8.425±0.10(predicted) | | InChI | 1S/C8H13N3O4/c1-3-6(5(2)11(14)15)4-7(10-13)8(9)12/h4-5,13H,3H2,1-2H3,(H2,9,12)/b6-4+,10-7+ | | InChIKey | MZAGXDHQGXUDDX-AGLLBGTNSA-N | | SMILES | CC\C(=C/C(=N\O)C(N)=O)C(C)[N+]([O-])=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | NOR-3 Usage And Synthesis |
| Uses | FK-409 is a NO donor. It liberates NO in a time-dependent manner with a half-life of approximately 40 minutes in phosphate buffer (pH 7.4) at 37°C. The IC50 for the inhibition of platelet aggregation is 4.9 μM. | | Uses | NOR-3 is a cell-permeable NO donor. | | Biological Activity | Activates intracellular guanylyl cyclase. |
| | NOR-3 Preparation Products And Raw materials |
|