| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2,3-Naphthalocyanine Basic information |
| | 2,3-Naphthalocyanine Chemical Properties |
| density | 1.506±0.06 g/cm3(Predicted) | | λmax | 712 nm | | BRN | 4345876 | | InChIKey | LKKPNUDVOYAOBB-UHFFFAOYSA-N | | SMILES | c1ccc2cc3c4nc(nc5[nH]c(nc6nc(nc7[nH]c(n4)c8cc9ccccc9cc78)c%10cc%11ccccc%11cc6%10)c%12cc%13ccccc%13cc5%12)c3cc2c1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2,3-Naphthalocyanine Usage And Synthesis |
| | 2,3-Naphthalocyanine Preparation Products And Raw materials |
|