| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,11,20,29-TETRA-TERT-BUTYL-2,3-NAPHTHALOCYANINE Basic information |
| Product Name: | 2,11,20,29-TETRA-TERT-BUTYL-2,3-NAPHTHALOCYANINE | | Synonyms: | 2,11,20,29-TETRA-TERT-BUTYL-2,3-NAPHTHALOCYANINE;2,11,20,29-Tetra-tert-butyl-2,3-naphthalocyanine Dye content 97 %;37H,39H-Tetranaphtho[2,3-b:2',3'-g:2'',3''-l:2''',3'''-q]porphyrazine, 2,11,20,29-tetrakis(1,1-dimethylethyl)-;2,11,20,29-Tetra-tert-butyl-2,3-naphthalocyanine | | CAS: | 58687-99-3 | | MF: | C64H58N8 | | MW: | 939.2 | | EINECS: | | | Product Categories: | Infrared (IR) DyesPhotonic and Optical Materials;Organic Electronics and Photonics;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 58687-99-3.mol |  |
| | 2,11,20,29-TETRA-TERT-BUTYL-2,3-NAPHTHALOCYANINE Chemical Properties |
| density | 1.267±0.06 g/cm3(Predicted) | | λmax | 784 nm | | InChIKey | FZJGGSUDHJDHRJ-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc2cc3c4nc(nc5[nH]c(nc6nc(nc7[nH]c(n4)c8cc9cc(ccc9cc78)C(C)(C)C)c%10cc%11cc(ccc%11cc6%10)C(C)(C)C)c%12cc%13cc(ccc%13cc5%12)C(C)(C)C)c3cc2c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2,11,20,29-TETRA-TERT-BUTYL-2,3-NAPHTHALOCYANINE Usage And Synthesis |
| | 2,11,20,29-TETRA-TERT-BUTYL-2,3-NAPHTHALOCYANINE Preparation Products And Raw materials |
|