| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 1-Azidoadamantane 97 Basic information |
| | 1-Azidoadamantane 97 Chemical Properties |
| Melting point | 80-82 °C(lit.) | | Fp | 85 °C | | storage temp. | 2-8°C | | form | powder or crystals | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C10H15N3/c11-13-12-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2/t7-,8+,9-,10- | | InChIKey | JOMZSYXWYOVFEE-CHIWXEEVSA-N | | SMILES | [N-]=[N+]=NC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-33 | | RIDADR | 1325 | | WGK Germany | 3 | | HazardClass | 4.1 | | PackingGroup | III | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 1 |
| | 1-Azidoadamantane 97 Usage And Synthesis |
| Uses | 1-Azidoadamantane is an organic azide. Dyes and metabolites. |
| | 1-Azidoadamantane 97 Preparation Products And Raw materials |
|