| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Methyl 3-(4 4 5 5-tetramethyl-1 3 2-dio& Basic information |
| Product Name: | Methyl 3-(4 4 5 5-tetramethyl-1 3 2-dio& | | Synonyms: | Methyl (Z)-oct-2-enoate-3-boronic acid pinacol ester;methyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-octenoate;2-Octenoic acid, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, methyl ester, (2E)-;Methyl (Z)-oct-2-enoate-3-boronic acid pinacol ester;Methyl 3-(4 4 5 5-tetramethyl-1 3 2-dio& | | CAS: | 352534-74-8 | | MF: | C15H27BO4 | | MW: | 282.18 | | EINECS: | | | Product Categories: | Alkenyl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents | | Mol File: | 352534-74-8.mol |  |
| | Methyl 3-(4 4 5 5-tetramethyl-1 3 2-dio& Chemical Properties |
| Boiling point | 287-288 °C(lit.) | | density | 0.965 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.455(lit.) | | Fp | >230 °F | | InChI | 1S/C15H27BO4/c1-7-8-9-10-12(11-13(17)18-6)16-19-14(2,3)15(4,5)20-16/h11H,7-10H2,1-6H3/b12-11- | | InChIKey | KIZPVRIPRYPEAY-QXMHVHEDSA-N | | SMILES | CCCCC\C(=C\C(=O)OC)B1OC(C)(C)C(C)(C)O1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Methyl 3-(4 4 5 5-tetramethyl-1 3 2-dio& Usage And Synthesis |
| | Methyl 3-(4 4 5 5-tetramethyl-1 3 2-dio& Preparation Products And Raw materials |
|