| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-Fluoroorotic acid hydrate, 98 Basic information |
| Product Name: | 5-Fluoroorotic acid hydrate, 98 | | Synonyms: | 2,6-Dihydroxy-5-fluoropyrimidine-4-carboxylic acid, 5-Fluorouracil-4-carboxylic acid;2,6-Dihydroxy-5-fluor-pyrimidin-4-carbonsure;5-Fluor-uracil-4-carbonsure;5-fluoro-1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylic acid hydrate;5-Fluoroorotic acid hydrate >=99.0% (TLC);5-FOA hydrate;5-Fluoroorotic Acid Hydrate (5-FOA Hydrate) for molecular biology, 98%;5-Fluoroorotic acid hydrate (ab146245) | | CAS: | 207291-81-4 | | MF: | C5H5FN2O5 | | MW: | 192.1 | | EINECS: | 211-876-0 | | Product Categories: | | | Mol File: | 207291-81-4.mol |  |
| | 5-Fluoroorotic acid hydrate, 98 Chemical Properties |
| Melting point | 278 °C (dec.)(lit.) | | storage temp. | -20°C | | solubility | 4 M NH4OH: soluble50mg/mL, clear, faintly yellow | | form | Solid | | color | White to Pale Yellow | | biological source | synthetic | | InChI | 1S/C5H3FN2O4.H2O/c6-1-2(4(10)11)7-5(12)8-3(1)9;/h(H,10,11)(H2,7,8,9,12);1H2 | | InChIKey | LODRRYMGPWQCTR-UHFFFAOYSA-N | | SMILES | OC(C(NC(N1)=O)=C(F)C1=O)=O.[H]O[H] | | CAS DataBase Reference | 207291-81-4 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | UV7800000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Fluoroorotic acid hydrate, 98 Usage And Synthesis |
| Chemical Properties | white to light orange crystalline powder | | Uses | 5-Fluoroorotic acid hydrate has also been used as a counter-selection agent to screen L. lactis (multi) peptidase knockout mutants and C. albicans. It has been used in synthesis of 5-fluoroorotidine 5′-monophosphate (FOMP). | | Biochem/physiol Actions | 5-Fluoroorotic acid is a selective inhibitor of rRNA synthesis in mammals. |
| | 5-Fluoroorotic acid hydrate, 98 Preparation Products And Raw materials |
|