|
|
| | N-Acetyl-DL-beta-phenylalanine* Basic information |
| Product Name: | N-Acetyl-DL-beta-phenylalanine* | | Synonyms: | N-ACETYL-3-PHENYL-DL-BETA-ALANINE;3-(acetylaMino)-3-phenylpropanoic acid;Benzenepropanoic acid, .beta.-(acetylamino)-;N-Acetyl-beta-phenyl-beta-alanine;Benzenepropanoic acid, β-(acetylamino)-;N-Acetyl-DL-β-phenylalanine;N-Acetyl-DL-β-phenylalanine;N-Acetyl-DL-2-phenylalanine | | CAS: | 40638-98-0 | | MF: | C11H13NO3 | | MW: | 207.23 | | EINECS: | | | Product Categories: | | | Mol File: | 40638-98-0.mol |  |
| | N-Acetyl-DL-beta-phenylalanine* Chemical Properties |
| Melting point | 164 °C | | Boiling point | 449.2±38.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.18±0.10(Predicted) | | BRN | 2726794 | | Major Application | peptide synthesis | | InChI | 1S/C11H13NO3/c1-8(13)12-10(7-11(14)15)9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15) | | InChIKey | HTWAFOFDKZAKQP-UHFFFAOYSA-N | | SMILES | CC(=O)NC(CC(O)=O)c1ccccc1 |
| WGK Germany | 3 | | F | 10 | | Storage Class | 13 - Non Combustible Solids |
| | N-Acetyl-DL-beta-phenylalanine* Usage And Synthesis |
| Uses | peptide synthesis | | Biological Activity | N-Acetyl-β-phenylalanine is a substrate for bacterial tRNA(Phe) peptidyltransferase. Hydrocinnamic acid is an aromatic lignin monomer.', 'N-Acetyl-DL-β-phenylalanine is a racemic mixture of N-acetylated β-phenylalanine enantiomers. N-Acetyl-DL-β-phenylalanine is a product generated from the chromogenic substrate N-acetyl-DL-phenylalanine β-napthyl ester by specific esterase(s). |
| | N-Acetyl-DL-beta-phenylalanine* Preparation Products And Raw materials |
|