|
|
| | (2R,3S)-N-Benzoyl-3-phenyl Isoserine Basic information |
| | (2R,3S)-N-Benzoyl-3-phenyl Isoserine Chemical Properties |
| Melting point | 169-172 °C (lit.) | | Boiling point | 580.7±50.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Slightly), DMSO (Slightly), Ethanol (Slightly) | | pka | 3.40±0.17(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D 40°, c = 1.0 in ethanol | | Major Application | peptide synthesis | | InChI | 1S/C16H15NO4/c18-14(16(20)21)13(11-7-3-1-4-8-11)17-15(19)12-9-5-2-6-10-12/h1-10,13-14,18H,(H,17,19)(H,20,21)/t13-,14+/m0/s1 | | InChIKey | HYJVYOWKYPNSTK-UONOGXRCSA-N | | SMILES | O[C@H]([C@@H](NC(=O)c1ccccc1)c2ccccc2)C(O)=O | | CAS DataBase Reference | 132201-33-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (2R,3S)-N-Benzoyl-3-phenyl Isoserine Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents. | | Uses | (2R,3S)-N-Benzoyl-3-phenylisoserine is an intermediate in the preparation of potent anticancer drug Paclitaxel (P132500) used to study the location of the binding sites. (2R,3S)-N-Benzoyl-3-phenylisoserine shows cytotoxic, antiviral and immunomodulatory activity. | | Uses | The presence of this chiral side chain has proven to be essential for the biological activity of taxol, one of the most promising anticancer agents being investigated. The challenging synthesis of taxol has stimulated interest in the attachment of the C-13 side chain to naturally derived taxanes like baccatin III. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | (2R,3S)-N-Benzoyl-3-phenyl Isoserine Preparation Products And Raw materials |
|