|
|
| | N N-diglycidylaniline Basic information |
| Product Name: | N N-diglycidylaniline | | Synonyms: | N,N-Diglycidylbenzenamine;Phenyldiglycidylamine;bis(2,3-epoxypropyl)aniline;bis(epoxypropyl)phenylamine;Diglycidylaniline;n-(oxiranylmethyl)-n-phenyl-oxiranemethanamin;n-(oxiranylmethyl)-n-phenyloxiranemethanamine;N-(oxiranylmethyl)-N-phenyl-Oxiranemethanamine | | CAS: | 2095-06-9 | | MF: | C12H15NO2 | | MW: | 205.25 | | EINECS: | 218-259-5 | | Product Categories: | | | Mol File: | 2095-06-9.mol |  |
| | N N-diglycidylaniline Chemical Properties |
| Boiling point | 204 °C(lit.) | | density | 1.153 g/mL at 25 °C(lit.) | | vapor pressure | 0.017Pa at 25℃ | | refractive index | n20/D 1.571(lit.) | | Fp | 113 °C | | pka | 4.13±0.50(Predicted) | | Water Solubility | 2.24g/L at 20℃ | | InChI | InChI=1S/C12H15NO2/c1-2-4-10(5-3-1)13(6-11-8-14-11)7-12-9-15-12/h1-5,11-12H,6-9H2 | | InChIKey | JAYXSROKFZAHRQ-UHFFFAOYSA-N | | SMILES | O1CC1CN(CC1CO1)C1=CC=CC=C1 | | LogP | 1.96 at 25℃ | | EPA Substance Registry System | Oxiranemethanamine, N-(oxiranylmethyl)-N-phenyl- (2095-06-9) |
| | N N-diglycidylaniline Usage And Synthesis |
| | N N-diglycidylaniline Preparation Products And Raw materials |
|