| Company Name: |
mahaloong Gold |
| Tel: |
028-81192082 18180560816 |
| Email: |
sales@mahaloong.com |
| Company Name: |
Tcichem, Inc. |
| Tel: |
13918644899 |
| Email: |
81587635@qq.com |
(2R)-2-(1,1-dimethylethyl)-2-methyl-1-[(4-methylphenyl)sulfonyl]aziridine manufacturers
|
| | (2R)-2-(1,1-dimethylethyl)-2-methyl-1-[(4-methylphenyl)sulfonyl]aziridine Basic information |
| | (2R)-2-(1,1-dimethylethyl)-2-methyl-1-[(4-methylphenyl)sulfonyl]aziridine Chemical Properties |
| Boiling point | 357.6±35.0 °C(Predicted) | | density | 1.150±0.06 g/cm3(Predicted) | | pka | -6.31±0.40(Predicted) | | InChI | InChI=1S/C14H21NO2S/c1-11-6-8-12(9-7-11)18(16,17)15-10-14(15,5)13(2,3)4/h6-9H,10H2,1-5H3/t14-,15/m0/s1 | | InChIKey | OKKPTYPQFAFGOT-MLCCFXAWSA-N | | SMILES | N1(S(C2=CC=C(C)C=C2)(=O)=O)C[C@]1(C(C)(C)C)C |
| | (2R)-2-(1,1-dimethylethyl)-2-methyl-1-[(4-methylphenyl)sulfonyl]aziridine Usage And Synthesis |
| Description | (2R)-2-(1,1-dimethylethyl)-2-methyl-1-[(4-methylphenyl)sulfonyl]aziridine is a key intermediate in the synthesis of Ibrexafungerb. Ibrexafungerb is an antimicrobial agent used to treat fungal or yeast infections, including vulvovaginal candidiasis. |
| | (2R)-2-(1,1-dimethylethyl)-2-methyl-1-[(4-methylphenyl)sulfonyl]aziridine Preparation Products And Raw materials |
|