| Company Name: |
ACE BIOSCIENCES
|
| Tel: |
+91-9395105396 |
| Email: |
kalisha@acebiosciences.in |
| Products Intro: |
Product Name:PBDE 183 (2,2',3,4,4',5',6-Heptabromodiphenyl ether)
CAS:207122-16-5
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
ShangHai Anpel Co, Ltd.
|
| Tel: |
18501792038 18502138905 |
| Email: |
shanpel@anpel.com.cn |
| Products Intro: |
Product Name:BDE 183
CAS:207122-16-5
Purity:50ppm Package:50mg/L于异辛烷，1ml Remarks:CDAA-350183-10mg
|
|
| | 2,23,4,45,6-HEPTABROMODIPHENYL ETHER Basic information |
| Product Name: | 2,23,4,45,6-HEPTABROMODIPHENYL ETHER | | Synonyms: | 2,2μ,3,4,4μ,5μ,6-HeptaBDE, PBDE 183, 2,2μ,3,4,4μ,5μ,6-Heptabromodiphenyl ether solution;2,2',3,4,4',5',6'-Heptabromodiphenyl ether,50 ug/mL in Isooctane;2,2′,3,4,4′,5′,6-HeptaBDE;1,2,3,5-Tetrabromo-4-(2,4,5-tribromophenoxy)benzene;PBDE 183(2，2‘，3，4，4‘，5‘，6-Heptabromodiphenyl ether);2,2',3,4,4',5',6-Heptabromodiphenyl ether(BDE 183) Solution;Benzene, 1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)-;2,2’,3,4,4’,5’,6-Heptabromodiphenylether Solution in Hexane, 100μg/mL | | CAS: | 207122-16-5 | | MF: | C12H3Br7O | | MW: | 722.48 | | EINECS: | 208-759-1 | | Product Categories: | | | Mol File: | 207122-16-5.mol |  |
| | 2,23,4,45,6-HEPTABROMODIPHENYL ETHER Chemical Properties |
| Melting point | 174-174.5 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 491 °C | | density | 2.643±0.06 g/cm3(Predicted) | | Fp | -12℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Light Yellow | | Henry's Law Constant | 1.4×102 mol/(m3Pa) at 25℃, Tittlemier et al. (2002) | | Major Application | environmental | | InChI | 1S/C12H3Br7O/c13-4-1-6(15)9(3-5(4)14)20-12-8(17)2-7(16)10(18)11(12)19/h1-3H | | InChIKey | ILPSCQCLBHQUEM-UHFFFAOYSA-N | | SMILES | Brc1cc(Br)c(Oc2c(Br)cc(Br)c(Br)c2Br)cc1Br | | EPA Substance Registry System | Benzene, 1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)- (207122-16-5) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 9-16-29-33-60-61-62 | | RIDADR | UN1262 - class 3 - PG 2 - Octanes, solution | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,23,4,45,6-HEPTABROMODIPHENYL ETHER Usage And Synthesis |
| Uses | BDE 183 is a polybrominated di-phenyl ether (PBDE) that is used as flame retardant in plastics and textile materials. It can be found in the adipose tissue, plasma, and human milk. One of the new POPs under the Stockholm Convention | | Definition | ChEBI: 2,2',3,4,4',5',6-Heptabromodiphenyl ether is an aromatic ether and an organobromine compound. |
| | 2,23,4,45,6-HEPTABROMODIPHENYL ETHER Preparation Products And Raw materials |
|