|
|
| | 2,2',3,3',4,4',5,5',6-nonabromodiphenylether Basic information |
| Product Name: | 2,2',3,3',4,4',5,5',6-nonabromodiphenylether | | Synonyms: | 2,2μ,3,3μ,4,4μ,5,5μ,6-NonaBDE, PBDE 206, 2,2μ,3,3μ,4,4μ,5,5μ,6-Nonabromodiphenyl ether solution;BDE No 206 solution;(2,3,4,5-Tetrabromophenyl)(pentabromophenyl) ether;2,3,4,5-Tetrabromophenyl(pentabromophenyl) ether;2,2',3,3',4',5,5',6-Nonabromodiphenyl ether;1,2,3,4,5-Pentabromo-6-(2,3,4,5-tetrabromophenoxy)benzene;PBDE 206(2,2',3,3',4,4',5,5',6-Nonabromodiphenyl ether);Benzene, 1,2,3,4,5-pentabromo-6-(2,3,4,5-tetrabromophenoxy)- | | CAS: | 63387-28-0 | | MF: | C12HBr9O | | MW: | 880.27 | | EINECS: | 208-759-1 | | Product Categories: | | | Mol File: | 63387-28-0.mol |  |
| | 2,2',3,3',4,4',5,5',6-nonabromodiphenylether Chemical Properties |
| Fp | -12 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly), THF (Slightly) | | form | Solid | | color | Off-White to Dark Red | | Henry's Law Constant | 4.7×101 mol/(m3Pa) at 25℃, Long et al. (2017) | | InChI | InChI=1S/C12HBr9O/c13-2-1-3(5(15)6(16)4(2)14)22-12-10(20)8(18)7(17)9(19)11(12)21/h1H | | InChIKey | CYRHBNRLQMLULE-UHFFFAOYSA-N | | SMILES | C1(Br)=C(OC2=CC(Br)=C(Br)C(Br)=C2Br)C(Br)=C(Br)C(Br)=C1Br | | EPA Substance Registry System | Benzene, 1,2,3,4,5-pentabromo-6-(2,3,4,5-tetrabromophenoxy)- (63387-28-0) |
| | 2,2',3,3',4,4',5,5',6-nonabromodiphenylether Usage And Synthesis |
| Uses | 1,2,3,4,5-Pentabromo-6-(2,3,4,5-tetrabromophenoxy)benzene is a polybrominated diphenyl ethers (PBDEs) found as a contaminant in soil. |
| | 2,2',3,3',4,4',5,5',6-nonabromodiphenylether Preparation Products And Raw materials |
| Raw materials | 2,2',3,3',4,4',5,6,6'-nonabde-->2,23,4,45,6-Heptabromodiphenyl ether-->Decabromodiphenyl oxide-->Diphenyl ether | | Preparation Products | 2,2,3,3,4,5,5,6,6-Nonabromodiphenyl ether |
|