| Company Name: |
PNP Biotech Co. Ltd
|
| Tel: |
+8618516098983 |
| Email: |
sales@pnpbiotech.com |
| Products Intro: |
Product Name:Teoc-MeLeu-OH
CAS:2411590-92-4
Purity:98% Package:25KG;USD
|
N-Teoc-N-methyl-L-leucine manufacturers
- Teoc-MeLeu-OH
-
- $0.00 / 25KG
-
2024-03-28
- CAS:2411590-92-4
- Min. Order: 25KG
- Purity: 98%
- Supply Ability: Inquiry
|
| | N-Teoc-N-methyl-L-leucine Basic information |
| Product Name: | N-Teoc-N-methyl-L-leucine | | Synonyms: | N-Teoc-N-methyl-L-leucine;L-Leucine, N-methyl-N-[[2-(trimethylsilyl)ethoxy]carbonyl]-;Teoc-MeLeu-OH;Teoc-N-Me-Leu-OH;(S)-4-Methyl-2-(methyl((2-(trimethylsilyl)ethoxy)carbonyl)amino)pentanoic acid;N-Methyl-N-((2-(trimethylsilyl)ethoxy)carbonyl)-L-leucine | | CAS: | 2411590-92-4 | | MF: | C13H27NO4Si | | MW: | 289.44 | | EINECS: | | | Product Categories: | | | Mol File: | 2411590-92-4.mol |  |
| | N-Teoc-N-methyl-L-leucine Chemical Properties |
| Boiling point | 369.5±35.0 °C(Predicted) | | density | 1.015±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | Solid | | pka | 4.05±0.21(Predicted) | | color | White to off-white | | InChI | InChI=1S/C13H27NO4Si/c1-10(2)9-11(12(15)16)14(3)13(17)18-7-8-19(4,5)6/h10-11H,7-9H2,1-6H3,(H,15,16)/t11-/m0/s1 | | InChIKey | ISZJODSUCSTOSW-NSHDSACASA-N | | SMILES | C(O)(=O)[C@H](CC(C)C)N(C)C(OCC[Si](C)(C)C)=O |
| | N-Teoc-N-methyl-L-leucine Usage And Synthesis |
| Uses | Teoc-MeLeu-OH is a leucine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | N-Teoc-N-methyl-L-leucine Preparation Products And Raw materials |
|