1,3-BIS(4-NITROPHENYL)-UREA-D8 manufacturers
|
| | 1,3-BIS(4-NITROPHENYL)-UREA-D8 Basic information |
| Product Name: | 1,3-BIS(4-NITROPHENYL)-UREA-D8 | | Synonyms: | 1,3-BIS(4-NITROPHENYL)-UREA-D8;N,N'-Bis(p-nitrophenyl)urea-d8;4,4'-Dinitrocarbanilide-d8;4,4′-Dinitrocarbanilide-d8 (rings-d8);D8-DNC;[2H8]-1,3-Bis(4-Nitrophenyl)Urea;Nicarbazin Impurity 1-d8;4,4’-Dinitrocarbanilide-d8 Solution in DMF, 100μg/mL | | CAS: | 1156508-87-0 | | MF: | C13H10N4O5 | | MW: | 302.25 | | EINECS: | | | Product Categories: | Amines, Aromatics, Isotope Labelled Compounds;Aromatics;Isotope Labelled Compounds;Amines | | Mol File: | Mol File |  |
| | 1,3-BIS(4-NITROPHENYL)-UREA-D8 Chemical Properties |
| Melting point | >300°C | | storage temp. | Refrigerator | | solubility | DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | color | Light Yellow to Yellow | | Major Application | forensics and toxicology veterinary | | InChI | InChI=1S/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) | | InChIKey | JEZZOKXIXNSKQD-UHFFFAOYSA-N | | SMILES | N(C1C([H])=C([H])C(N(=O)=O)=C([H])C=1[H])C(=O)NC1C([H])=C([H])C(N(=O)=O)=C([H])C=1[H] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 1,3-BIS(4-NITROPHENYL)-UREA-D8 Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | The active labelled component of the antifertility agent nicarbazin, in chicken, duck, and goose plasma. |
| | 1,3-BIS(4-NITROPHENYL)-UREA-D8 Preparation Products And Raw materials |
|