1,3-Bis(4-nitrophenyl)urea manufacturers
|
| | 1,3-Bis(4-nitrophenyl)urea Basic information |
| Product Name: | 1,3-Bis(4-nitrophenyl)urea | | Synonyms: | N,N'-BIS(4-NITROPHENYL)UREA;N,N'-Bis(p-nitrophenyl)urea;N,N'-Di(4-nitrophenyl)urea;N,N,N-TRIMETHYLGLYCINEHYDROXIDE;1,3-Bis(4-nitrophenyl)urea 97%;Nicarbazin Related Compound;Urea,N,N'-bis(4-nitrophenyl)-;4',4''-DINITROCARBANILIDE | | CAS: | 587-90-6 | | MF: | C13H10N4O5 | | MW: | 302.24 | | EINECS: | 209-607-7 | | Product Categories: | Miscellaneous Biochemicals;Amines;Aromatics;B;Bioactive Small Molecules;Building Blocks;Carbonyl Compounds;Cell Biology;Chemical Synthesis;Organic Building Blocks;Ureas | | Mol File: | 587-90-6.mol |  |
| | 1,3-Bis(4-nitrophenyl)urea Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 443.29°C (rough estimate) | | density | 1.3627 (rough estimate) | | refractive index | 1.6120 (estimate) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMF (Slightly), DMSO (Slightly, Heated) | | form | Solid | | pka | 12.44±0.70(Predicted) | | color | Yellow | | Merck | 14,3278 | | BRN | 2225762 | | InChI | 1S/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) | | InChIKey | JEZZOKXIXNSKQD-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(NC(=O)Nc2ccc(cc2)[N+]([O-])=O)cc1 | | CAS DataBase Reference | 587-90-6(CAS DataBase Reference) | | EPA Substance Registry System | Urea, N,N'-bis(4-nitrophenyl)- (587-90-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2921490090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Bis(4-nitrophenyl)urea Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | The active component of the antifertility agent nicarbazin, in chicken, duck, and goose plasma. | | Uses | 1,3-Bis(4-nitrophenyl)urea is the active component of the antifertility agent nicarbazin, in chicken, duck, and goose plasma. | | Purification Methods | Crystallise the urea from EtOH (m 364o, long heating), EtOH/Me2CO (m 301-303o, 300-304o dec, 318-319o) or Me2CO (m 289o dec). It sublimes in vacuo.[Beilstein 12 H 723, 12 II 393, 12 III 1619, 12 IV 1646.] |
| | 1,3-Bis(4-nitrophenyl)urea Preparation Products And Raw materials |
|