|
|
| | 5-Maleimido valeric acid Basic information |
| Product Name: | 5-Maleimido valeric acid | | Synonyms: | 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acid;1H-Pyrrole-1-pentanoic acid, 2,5-dihydro-2,5-dioxo-;5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl);5-Maleimido-pentanoic acid;AUN78996;5-maleimidylvaleric acid;5-(2,5-dioxopyrrol-1-yl)pentanoic acid;MVA | | CAS: | 57078-99-6 | | MF: | C9H11NO4 | | MW: | 197.19 | | EINECS: | | | Product Categories: | | | Mol File: | 57078-99-6.mol |  |
| | 5-Maleimido valeric acid Chemical Properties |
| Melting point | 84-85 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 400.7±28.0 °C(Predicted) | | density | 1.334±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 4.67±0.10(Predicted) | | color | Off-white to yellow | | InChI | InChI=1S/C9H11NO4/c11-7-4-5-8(12)10(7)6-2-1-3-9(13)14/h4-5H,1-3,6H2,(H,13,14) | | InChIKey | ACVAAFHNDGTZLL-UHFFFAOYSA-N | | SMILES | N1(CCCCC(O)=O)C(=O)C=CC1=O |
| | 5-Maleimido valeric acid Usage And Synthesis |
| Description | 5-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pentanoic acid contains a maleimide group and a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. | | Uses | 5-Maleimidopentanoic Acid is a potential inhibitor of prostaglandin endoperoxide synthase (PGHS). | | IC 50 | Cleavable Linker |
| | 5-Maleimido valeric acid Preparation Products And Raw materials |
|