|
|
| | 6-JOE SE Basic information |
| Product Name: | 6-JOE SE | | Synonyms: | 6-JOE, SE;6-CARBOXY-4',5'-DICHLORO-2',7'-DIMETHOXYFLUORESCEIN N-HYDROXYSUCCINIMIDE ESTER;6-CARBOXY-4',5'-DICHLORO-2',7'-DIMETHOXYFLUORESCEIN, SUCCINIMIDYL ESTER;6-CARBOXY-4',5'-DICHLORO-2',7"-*DIMETHOXYFLUOROSCEI;6-Carboxy-4',5'-dichloro-2',7'-dimethoxyfluorescein;6-JOE, SE [6-Carboxy-4',5'-dichloro-2',7'-dimethoxyfluorescein, succinimidyl ester] *CAS#: 113394-23-3*;2,5-Dioxopyrrolidin-1-yl 4',5'-dichloro-3',6'-dihydroxy-2',7'-diMethoxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylate;6-Joe, SE [6-Carboxy-4',5'-Dichloro-2',7'-DiMethoxyfluorescein, SucciniMidyl Ester] | | CAS: | 113394-23-3 | | MF: | C27H17Cl2NO11 | | MW: | 602.33 | | EINECS: | | | Product Categories: | Fluorescent Dyes | | Mol File: | 113394-23-3.mol |  |
| | 6-JOE SE Chemical Properties |
| Boiling point | 835.6±75.0 °C(Predicted) | | density | 1.79±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | water: slightly soluble | | pka | 7.73±0.20(Predicted) | | form | solid | | color | red | | Water Solubility | water: slightly soluble | | λmax | (78,000 at 521 nm in 50 mmol phosphate bufferpH 12) | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChIKey | UUVBVONAGUSCCH-UHFFFAOYSA-N | | SMILES | COc1cc2c(Oc3c(Cl)c(O)c(OC)cc3C24OC(=O)c5ccc(cc45)C(=O)ON6C(=O)CCC6=O)c(Cl)c1O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 6-JOE SE Usage And Synthesis |
| Uses | Amine-Reactive Fluorescent probe, 6-JOE, SE has similar absorption and emission spectra of rhodamine 6G, and is mainly used in automated DNA sequencing. | | Uses | 6-JOE SE is an automated DNA sequencing fluorophore. Dyes and metabolites. | | General Description | A traditional fluorophore used in automated DNA sequencing. Characterized by an intermediate-wavelength spectra, high quantum yield, and low pH sensitivity in the physiological range. |
| | 6-JOE SE Preparation Products And Raw materials |
|