|
|
| | Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride Basic information |
| | Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride Chemical Properties |
| Melting point | 160-170 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | very faint turbidity in hot Water | | form | Powder | | color | Pink to cream | | BRN | 3918980 | | InChI | InChI=1S/C15H19NO3.ClH/c1-2-19-15(18)13-11-16(9-8-14(13)17)10-12-6-4-3-5-7-12;/h3-7,13H,2,8-11H2,1H3;1H | | InChIKey | YPFMNHZRNXPYBG-UHFFFAOYSA-N | | SMILES | N1(CCC(=O)C(C(=O)OCC)C1)CC1C=CC=CC=1.Cl | | CAS DataBase Reference | 1454-53-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride Usage And Synthesis |
| Chemical Properties | Pink to cream powder | | Uses | Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride is also known as 1-benzyl-3-ethoxycarbonyl-4-piperidone hydrochloride. | | Synthesis Reference(s) | Synthetic Communications, 25, p. 177, 1995 DOI: 10.1080/00397919508010804 | | General Description | Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride is also known as 1-benzyl-3-ethoxycarbonyl-4-piperidone hydrochloride. |
| | Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate hydrochloride Preparation Products And Raw materials |
|