| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,3,5[10]-Estratriene-3,17beta-diol 3-glucuronide 17-sulfate dipotassium salt Basic information |
| Product Name: | 1,3,5[10]-Estratriene-3,17beta-diol 3-glucuronide 17-sulfate dipotassium salt | | Synonyms: | 3,17BETA-DIHYDROXY-1,3,5[10]-ESTRATRIENE 3-GLUCURONIDE 17-SULFATE DIPOTASSIUM SALT;17BETA-ESTRADIOL 3-GLUCURONIDE 17-SULFATE DIPOTASSIUM SALT;17B-ESTRADIOL 3-GLUCURONIDE 17-*SULFATE DIPOTASSIUM;dipotassium estradiol-17β 3-(β-D-glucuronide)-17-sulfate;oestradiol 3-glucuronide 17-sulfate, dipotassium salt;1,3,5(10)-Estratriene-3,17β-diol 3-glucuronide 17-sulfate, 3,17β-Dihydroxy-1,3,5(10)-estratriene 3-glucuronide 17-sulfate;β-Estradiol 3-(β-D-glucuronide) 17-sulfate dipotassium salt;1,3,5(10)-Estratriene-3,17β-diol 3-glucuronide 17-sulfate | | CAS: | 99156-45-3 | | MF: | C24H30K2O11S | | MW: | 604.75 | | EINECS: | | | Product Categories: | | | Mol File: | 99156-45-3.mol | ![1,3,5[10]-Estratriene-3,17beta-diol 3-glucuronide 17-sulfate dipotassium salt Structure](CAS/GIF/99156-45-3.gif) |
| | 1,3,5[10]-Estratriene-3,17beta-diol 3-glucuronide 17-sulfate dipotassium salt Chemical Properties |
| storage temp. | −20°C | | solubility | water: 50 mg/mL, clear, colorless | | form | powder | | Water Solubility | water: 50mg/mL, clear, colorless | | InChIKey | HHYDRCVKADTNKW-UHFFFAOYSA-N | | SMILES | [K].CC12CCC3C(CCc4cc(OC5OC(C(O)C(O)C5O)C(O)=O)ccc34)C1CCC2OS(O)(=O)=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 |
| | 1,3,5[10]-Estratriene-3,17beta-diol 3-glucuronide 17-sulfate dipotassium salt Usage And Synthesis |
| Uses | β-Estradiol 3-(β-D-Glucuronide) 17-Sulfate Dipotassium Salt is the salt of the free acid β-Estradiol 3-(β-D-Glucuronide) 17-Sulfate, formed in vitro by human mammary cancer cells. | | Biochem/physiol Actions | Estradiol is derived from estrogen and it exists as a conjugate as sulfate and glucuronides. This conjugation enables in bringing down the estradiol hormonal activity and aids in eliminating them through excretion. |
| | 1,3,5[10]-Estratriene-3,17beta-diol 3-glucuronide 17-sulfate dipotassium salt Preparation Products And Raw materials |
|